About 2-iodobutylbenzene
2-iodobutylbenzene (PubChem CID 11196235) has the molecular formula C10H13I
and a molecular weight of 260.12 g/mol. Its IUPAC name is 2-iodobutylbenzene.
Molecular Properties
| Compound Name | 2-iodobutylbenzene |
| PubChem CID | 11196235 |
| Molecular Formula | C10H13I |
| Molecular Weight | 260.12 g/mol |
| Exact Mass | 260.01 |
| IUPAC Name | 2-iodobutylbenzene |
| SMILES | CCC(I)Cc1ccccc1 |
| InChI | InChI=1S/C10H13I/c1-2-10(11)8-9-6-4-3-5-7-9/h3-7,10H,2,8H2,1H3 |
| InChIKey | INNGNQFJHJJZOB-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.12 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-iodobutylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iodobutylbenzene?
The IUPAC name of 2-iodobutylbenzene (CID 11196235) is 2-iodobutylbenzene.
What is the SMILES notation for 2-iodobutylbenzene?
The canonical SMILES for 2-iodobutylbenzene is CCC(I)Cc1ccccc1.
What is the InChIKey of 2-iodobutylbenzene?
The InChIKey is INNGNQFJHJJZOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13I/c1-2-10(11)8-9-6-4-3-5-7-9/h3-7,10H,2,8H2,1H3.
What are the key properties of 2-iodobutylbenzene?
2-iodobutylbenzene has a molecular weight of 260.12 g/mol, XLogP of 3.44, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iodobutylbenzene is sourced from PubChem (CID 11196235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).