C25H30N2O2 — CID 170972321
6-[(11Z)-6H-benzo[c][1]benzazocin-5-yl]-N-(2-methylpropyl)-6-oxohexanamide (PubChem CID 170972321) has the molecular formula C25H30N2O2 and a molecular weight of 390.53 g/mol. Its IUPAC name is 6-[(11Z)-6H-benzo[c][1]benzazocin-5-yl]-N-(2-methylpropyl)-6-oxohexanamide.
| Compound Name | 6-[(11Z)-6H-benzo[c][1]benzazocin-5-yl]-N-(2-methylpropyl)-6-oxohexanamide |
|---|---|
| PubChem CID | 170972321 |
| Molecular Formula | C25H30N2O2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | 6-[(11Z)-6H-benzo[c][1]benzazocin-5-yl]-N-(2-methylpropyl)-6-oxohexanamide |
| SMILES | CC(C)CNC(=O)CCCCC(=O)N1Cc2ccccc2/C=C\c2ccccc21 |
| InChI | InChI=1S/C25H30N2O2/c1-19(2)17-26-24(28)13-7-8-14-25(29)27-18-22-11-4-3-9-20(22)15-16-21-10-5-6-12-23(21)27/h3-6,9-12,15-16,19H,7-8,13-14,17-18H2,1-2H3,(H,26,28)/b16-15- |
| InChIKey | HLEARJCQJIVSGV-NXVVXOECSA-N |
| XLogP | 5.04 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|