C25H30N2O4 — CID 155223537
4-[(11Z)-6H-benzo[c][1]benzazocin-5-yl]-N-[2-(3-methoxypropoxy)ethyl]-4-oxobutanamide (PubChem CID 155223537) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is 4-[(11Z)-6H-benzo[c][1]benzazocin-5-yl]-N-[2-(3-methoxypropoxy)ethyl]-4-oxobutanamide.
| Compound Name | 4-[(11Z)-6H-benzo[c][1]benzazocin-5-yl]-N-[2-(3-methoxypropoxy)ethyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 155223537 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | 4-[(11Z)-6H-benzo[c][1]benzazocin-5-yl]-N-[2-(3-methoxypropoxy)ethyl]-4-oxobutanamide |
| SMILES | COCCCOCCNC(=O)CCC(=O)N1Cc2ccccc2/C=C\c2ccccc21 |
| InChI | InChI=1S/C25H30N2O4/c1-30-16-6-17-31-18-15-26-24(28)13-14-25(29)27-19-22-9-3-2-7-20(22)11-12-21-8-4-5-10-23(21)27/h2-5,7-12H,6,13-19H2,1H3,(H,26,28)/b12-11- |
| InChIKey | CXFAJAVQTSNHGA-QXMHVHEDSA-N |
| XLogP | 3.65 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|