C34H42N4O7S — CID 176682037
N-[2-[2-[3-[[3-[(11Z)-6H-benzo[c][1]benzazocin-5-yl]-3-oxopropyl]amino]-3-oxopropoxy]ethoxy]ethyl]-3-(3-ethylsulfanyl-2,5-dioxopyrrolidin-1-yl)propanamide (PubChem CID 176682037) has the molecular formula C34H42N4O7S and a molecular weight of 650.80 g/mol. Its IUPAC name is N-[2-[2-[3-[[3-[(11Z)-6H-benzo[c][1]benzazocin-5-yl]-3-oxopropyl]amino]-3-oxopropoxy]ethoxy]ethyl]-3-(3-ethylsulfanyl-2,5-dioxopyrrolidin-1-yl)propanamide.
| Compound Name | N-[2-[2-[3-[[3-[(11Z)-6H-benzo[c][1]benzazocin-5-yl]-3-oxopropyl]amino]-3-oxopropoxy]ethoxy]ethyl]-3-(3-ethylsulfanyl-2,5-dioxopyrrolidin-1-yl)propanamide |
|---|---|
| PubChem CID | 176682037 |
| Molecular Formula | C34H42N4O7S |
| Molecular Weight | 650.80 g/mol |
| Exact Mass | 650.28 |
| IUPAC Name | N-[2-[2-[3-[[3-[(11Z)-6H-benzo[c][1]benzazocin-5-yl]-3-oxopropyl]amino]-3-oxopropoxy]ethoxy]ethyl]-3-(3-ethylsulfanyl-2,5-dioxopyrrolidin-1-yl)propanamide |
| SMILES | CCSC1CC(=O)N(CCC(=O)NCCOCCOCCC(=O)NCCC(=O)N2Cc3ccccc3/C=C\c3ccccc32)C1=O |
| InChI | InChI=1S/C34H42N4O7S/c1-2-46-29-23-33(42)37(34(29)43)18-14-30(39)36-17-20-45-22-21-44-19-15-31(40)35-16-13-32(41)38-24-27-9-4-3-7-25(27)11-12-26-8-5-6-10-28(26)38/h3-12,29H,2,13-24H2,1H3,(H,35,40)(H,36,39)/b12-11- |
| InChIKey | OUQIUEOUCWDUED-QXMHVHEDSA-N |
| XLogP | 3.02 |
| TPSA | 134.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.80 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|