C32H39N3O4S2 — CID 169232187
N-[3-(11,12-dihydro-6H-benzo[c][1]benzazocin-5-yl)-3-oxopropyl]-3-[3-(2,4-dimethyl-2-sulfanylpent-4-enyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]propanamide (PubChem CID 169232187) has the molecular formula C32H39N3O4S2 and a molecular weight of 593.82 g/mol. Its IUPAC name is N-[3-(11,12-dihydro-6H-benzo[c][1]benzazocin-5-yl)-3-oxopropyl]-3-[3-(2,4-dimethyl-2-sulfanylpent-4-enyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]propanamide.
| Compound Name | N-[3-(11,12-dihydro-6H-benzo[c][1]benzazocin-5-yl)-3-oxopropyl]-3-[3-(2,4-dimethyl-2-sulfanylpent-4-enyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]propanamide |
|---|---|
| PubChem CID | 169232187 |
| Molecular Formula | C32H39N3O4S2 |
| Molecular Weight | 593.82 g/mol |
| Exact Mass | 593.24 |
| IUPAC Name | N-[3-(11,12-dihydro-6H-benzo[c][1]benzazocin-5-yl)-3-oxopropyl]-3-[3-(2,4-dimethyl-2-sulfanylpent-4-enyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]propanamide |
| SMILES | C=C(C)CC(C)(S)CSC1CC(=O)N(CCC(=O)NCCC(=O)N2Cc3ccccc3CCc3ccccc32)C1=O |
| InChI | InChI=1S/C32H39N3O4S2/c1-22(2)19-32(3,40)21-41-27-18-30(38)34(31(27)39)17-15-28(36)33-16-14-29(37)35-20-25-10-5-4-8-23(25)12-13-24-9-6-7-11-26(24)35/h4-11,27,40H,1,12-21H2,2-3H3,(H,33,36) |
| InChIKey | ZOCPXBUUUIKEBJ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.82 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|