C59H81BN8O12P2S — CID 172597969
CID 172597969 (PubChem CID 172597969) has the molecular formula C59H81BN8O12P2S and a molecular weight of 1199.17 g/mol.
| Compound Name | CID 172597969 |
|---|---|
| PubChem CID | 172597969 |
| Molecular Formula | C59H81BN8O12P2S |
| Molecular Weight | 1199.17 g/mol |
| Exact Mass | 1198.53 |
| IUPAC Name | — |
| SMILES | CC.O=C(CCN1C(=O)CC(SCCCCCCOP(O)O)C1=O)NCCC(=O)N1Cc2ccccc2CCc2ccccc21.[B]N(N)/C1=C(\N)c2ccccc2N(C(=O)CCC(=O)NCCCCCCOP(=C)(O)O)Cc2ccccc21 |
| InChI | InChI=1S/C31H40N3O7PS.C26H35BN5O5P.C2H6/c35-28(16-18-33-30(37)21-27(31(33)38)43-20-8-2-1-7-19-41-42(39)40)32-17-15-29(36)34-22-25-11-4-3-9-23(25)13-14-24-10-5-6-12-26(24)34;1-38(35,36)37-17-9-3-2-8-16-30-23(33)14-15-24(34)31-18-19-10-4-5-11-20(19)26(32(27)29)25(28)21-12-6-7-13-22(21)31;1-2/h3-6,9-12,27,39-40H,1-2,7-8,13-22H2,(H,32,35);4-7,10-13,35-36H,1-3,8-9,14-18,28-29H2,(H,30,33);1-2H3/b;26-25-; |
| InChIKey | DARCOQCWDFZEEF-RACWBJBRSA-N |
| XLogP | 7.12 |
| TPSA | 290.86 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 83 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1199.17 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|