C25H32N3O5PS — CID 169146802
4-[(11E)-12-amino-6H-benzo[c][1]benzazocin-5-yl]-N-(6-dihydroxyphosphinothioyloxyhexyl)-4-oxobutanamide (PubChem CID 169146802) has the molecular formula C25H32N3O5PS and a molecular weight of 517.59 g/mol. Its IUPAC name is 4-[(11E)-12-amino-6H-benzo[c][1]benzazocin-5-yl]-N-(6-dihydroxyphosphinothioyloxyhexyl)-4-oxobutanamide.
| Compound Name | 4-[(11E)-12-amino-6H-benzo[c][1]benzazocin-5-yl]-N-(6-dihydroxyphosphinothioyloxyhexyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 169146802 |
| Molecular Formula | C25H32N3O5PS |
| Molecular Weight | 517.59 g/mol |
| Exact Mass | 517.18 |
| IUPAC Name | 4-[(11E)-12-amino-6H-benzo[c][1]benzazocin-5-yl]-N-(6-dihydroxyphosphinothioyloxyhexyl)-4-oxobutanamide |
| SMILES | N/C1=C/c2ccccc2CN(C(=O)CCC(=O)NCCCCCCOP(O)(O)=S)c2ccccc21 |
| InChI | InChI=1S/C25H32N3O5PS/c26-22-17-19-9-3-4-10-20(19)18-28(23-12-6-5-11-21(22)23)25(30)14-13-24(29)27-15-7-1-2-8-16-33-34(31,32)35/h3-6,9-12,17H,1-2,7-8,13-16,18,26H2,(H,27,29)(H2,31,32,35)/b22-17+ |
| InChIKey | ZQPSJIQTNUUWOC-OQKWZONESA-N |
| XLogP | 3.67 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.59 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|