C28H35N2O6P — CID 122548736
6-[[6-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-6-oxohexanoyl]amino]hexyl methyl hydrogen phosphate (PubChem CID 122548736) has the molecular formula C28H35N2O6P and a molecular weight of 526.57 g/mol. Its IUPAC name is 6-[[6-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-6-oxohexanoyl]amino]hexyl methyl hydrogen phosphate.
| Compound Name | 6-[[6-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-6-oxohexanoyl]amino]hexyl methyl hydrogen phosphate |
|---|---|
| PubChem CID | 122548736 |
| Molecular Formula | C28H35N2O6P |
| Molecular Weight | 526.57 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | 6-[[6-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-6-oxohexanoyl]amino]hexyl methyl hydrogen phosphate |
| SMILES | COP(=O)(O)OCCCCCCNC(=O)CCCCC(=O)N1Cc2ccccc2C#Cc2ccccc21 |
| InChI | InChI=1S/C28H35N2O6P/c1-35-37(33,34)36-21-11-3-2-10-20-29-27(31)16-8-9-17-28(32)30-22-25-14-5-4-12-23(25)18-19-24-13-6-7-15-26(24)30/h4-7,12-15H,2-3,8-11,16-17,20-22H2,1H3,(H,29,31)(H,33,34) |
| InChIKey | ABTQGUKEEBBBRA-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.57 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|