C31H41N3O4 — CID 129014081
N-[3-(3-amino-3-methoxybutoxy)-3-methylbutyl]-6-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-6-oxohexanamide (PubChem CID 129014081) has the molecular formula C31H41N3O4 and a molecular weight of 519.69 g/mol. Its IUPAC name is N-[3-(3-amino-3-methoxybutoxy)-3-methylbutyl]-6-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-6-oxohexanamide.
| Compound Name | N-[3-(3-amino-3-methoxybutoxy)-3-methylbutyl]-6-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-6-oxohexanamide |
|---|---|
| PubChem CID | 129014081 |
| Molecular Formula | C31H41N3O4 |
| Molecular Weight | 519.69 g/mol |
| Exact Mass | 519.31 |
| IUPAC Name | N-[3-(3-amino-3-methoxybutoxy)-3-methylbutyl]-6-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-6-oxohexanamide |
| SMILES | COC(C)(N)CCOC(C)(C)CCNC(=O)CCCCC(=O)N1Cc2ccccc2C#Cc2ccccc21 |
| InChI | InChI=1S/C31H41N3O4/c1-30(2,38-22-20-31(3,32)37-4)19-21-33-28(35)15-9-10-16-29(36)34-23-26-13-6-5-11-24(26)17-18-25-12-7-8-14-27(25)34/h5-8,11-14H,9-10,15-16,19-23,32H2,1-4H3,(H,33,35) |
| InChIKey | YUFYFZHLYSCFMR-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.69 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|