C35H48N3O6PS2 — CID 135215296
6-[4-[2-[[4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxobutanoyl]amino]ethyldisulfanyl]pentanoylamino]hexoxy-propan-2-ylphosphinic acid (PubChem CID 135215296) has the molecular formula C35H48N3O6PS2 and a molecular weight of 701.89 g/mol. Its IUPAC name is 6-[4-[2-[[4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxobutanoyl]amino]ethyldisulfanyl]pentanoylamino]hexoxy-propan-2-ylphosphinic acid.
| Compound Name | 6-[4-[2-[[4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxobutanoyl]amino]ethyldisulfanyl]pentanoylamino]hexoxy-propan-2-ylphosphinic acid |
|---|---|
| PubChem CID | 135215296 |
| Molecular Formula | C35H48N3O6PS2 |
| Molecular Weight | 701.89 g/mol |
| Exact Mass | 701.27 |
| IUPAC Name | 6-[4-[2-[[4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxobutanoyl]amino]ethyldisulfanyl]pentanoylamino]hexoxy-propan-2-ylphosphinic acid |
| SMILES | CC(CCC(=O)NCCCCCCOP(=O)(O)C(C)C)SSCCNC(=O)CCC(=O)N1Cc2ccccc2C#Cc2ccccc21 |
| InChI | InChI=1S/C35H48N3O6PS2/c1-27(2)45(42,43)44-24-11-5-4-10-22-36-33(39)19-16-28(3)47-46-25-23-37-34(40)20-21-35(41)38-26-31-14-7-6-12-29(31)17-18-30-13-8-9-15-32(30)38/h6-9,12-15,27-28H,4-5,10-11,16,19-26H2,1-3H3,(H,36,39)(H,37,40)(H,42,43) |
| InChIKey | OMXOQNZWRIMCQY-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.89 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|