C31H42N3O6PS2 — CID 145199398
6-[3-[[3-[[3-[(11Z)-6H-benzo[c][1]benzazocin-5-yl]-3-oxopropyl]amino]-3-oxopropyl]disulfanyl]propanoylamino]hexoxy-methylphosphinic acid (PubChem CID 145199398) has the molecular formula C31H42N3O6PS2 and a molecular weight of 647.80 g/mol. Its IUPAC name is 6-[3-[[3-[[3-[(11Z)-6H-benzo[c][1]benzazocin-5-yl]-3-oxopropyl]amino]-3-oxopropyl]disulfanyl]propanoylamino]hexoxy-methylphosphinic acid.
| Compound Name | 6-[3-[[3-[[3-[(11Z)-6H-benzo[c][1]benzazocin-5-yl]-3-oxopropyl]amino]-3-oxopropyl]disulfanyl]propanoylamino]hexoxy-methylphosphinic acid |
|---|---|
| PubChem CID | 145199398 |
| Molecular Formula | C31H42N3O6PS2 |
| Molecular Weight | 647.80 g/mol |
| Exact Mass | 647.23 |
| IUPAC Name | 6-[3-[[3-[[3-[(11Z)-6H-benzo[c][1]benzazocin-5-yl]-3-oxopropyl]amino]-3-oxopropyl]disulfanyl]propanoylamino]hexoxy-methylphosphinic acid |
| SMILES | CP(=O)(O)OCCCCCCNC(=O)CCSSCCC(=O)NCCC(=O)N1Cc2ccccc2/C=C\c2ccccc21 |
| InChI | InChI=1S/C31H42N3O6PS2/c1-41(38,39)40-21-9-3-2-8-19-32-29(35)17-22-42-43-23-18-30(36)33-20-16-31(37)34-24-27-12-5-4-10-25(27)14-15-26-11-6-7-13-28(26)34/h4-7,10-15H,2-3,8-9,16-24H2,1H3,(H,32,35)(H,33,36)(H,38,39)/b15-14- |
| InChIKey | VCVDBMJQXRCVOC-PFONDFGASA-N |
| XLogP | 5.88 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.80 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|