C30H40N5O5P — CID 174195064
6-[[6-(5-ethyl-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),3,7,9,11,15,17-octaen-13-yl)-6-oxohexanoyl]amino]hexoxy-methylphosphinic acid (PubChem CID 174195064) has the molecular formula C30H40N5O5P and a molecular weight of 581.65 g/mol. Its IUPAC name is 6-[[6-(5-ethyl-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),3,7,9,11,15,17-octaen-13-yl)-6-oxohexanoyl]amino]hexoxy-methylphosphinic acid.
| Compound Name | 6-[[6-(5-ethyl-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),3,7,9,11,15,17-octaen-13-yl)-6-oxohexanoyl]amino]hexoxy-methylphosphinic acid |
|---|---|
| PubChem CID | 174195064 |
| Molecular Formula | C30H40N5O5P |
| Molecular Weight | 581.65 g/mol |
| Exact Mass | 581.28 |
| IUPAC Name | 6-[[6-(5-ethyl-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),3,7,9,11,15,17-octaen-13-yl)-6-oxohexanoyl]amino]hexoxy-methylphosphinic acid |
| SMILES | CCn1nnc2c1-c1ccccc1N(C(=O)CCCCC(=O)NCCCCCCOP(C)(=O)O)Cc1ccccc1-2 |
| InChI | InChI=1S/C30H40N5O5P/c1-3-35-30-25-16-8-9-17-26(25)34(22-23-14-6-7-15-24(23)29(30)32-33-35)28(37)19-11-10-18-27(36)31-20-12-4-5-13-21-40-41(2,38)39/h6-9,14-17H,3-5,10-13,18-22H2,1-2H3,(H,31,36)(H,38,39) |
| InChIKey | XBASWXPGGSVVFC-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.65 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|