C29H38N5O7P — CID 174195054
[2-hydroxy-3-[3-[[6-(3-methyl-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),4,7,9,11,15,17-octaen-13-yl)-6-oxohexanoyl]amino]propoxy]propoxy]-methylphosphinic acid (PubChem CID 174195054) has the molecular formula C29H38N5O7P and a molecular weight of 599.62 g/mol. Its IUPAC name is [2-hydroxy-3-[3-[[6-(3-methyl-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),4,7,9,11,15,17-octaen-13-yl)-6-oxohexanoyl]amino]propoxy]propoxy]-methylphosphinic acid.
| Compound Name | [2-hydroxy-3-[3-[[6-(3-methyl-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),4,7,9,11,15,17-octaen-13-yl)-6-oxohexanoyl]amino]propoxy]propoxy]-methylphosphinic acid |
|---|---|
| PubChem CID | 174195054 |
| Molecular Formula | C29H38N5O7P |
| Molecular Weight | 599.62 g/mol |
| Exact Mass | 599.25 |
| IUPAC Name | [2-hydroxy-3-[3-[[6-(3-methyl-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),4,7,9,11,15,17-octaen-13-yl)-6-oxohexanoyl]amino]propoxy]propoxy]-methylphosphinic acid |
| SMILES | Cn1nnc2c1-c1ccccc1CN(C(=O)CCCCC(=O)NCCCOCC(O)COP(C)(=O)O)c1ccccc1-2 |
| InChI | InChI=1S/C29H38N5O7P/c1-33-29-23-11-4-3-10-21(23)18-34(25-13-6-5-12-24(25)28(29)31-32-33)27(37)15-8-7-14-26(36)30-16-9-17-40-19-22(35)20-41-42(2,38)39/h3-6,10-13,22,35H,7-9,14-20H2,1-2H3,(H,30,36)(H,38,39) |
| InChIKey | SMUJPDHXVPPLOY-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 156.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.62 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|