C34H45N5O4 — CID 160616157
4-[3-(5-methylhexyl)-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),4,7,9,11,15,17-octaen-13-yl]-N-[2-(4-methyl-3-oxopentoxy)ethyl]-4-oxobutanamide (PubChem CID 160616157) has the molecular formula C34H45N5O4 and a molecular weight of 587.76 g/mol. Its IUPAC name is 4-[3-(5-methylhexyl)-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),4,7,9,11,15,17-octaen-13-yl]-N-[2-(4-methyl-3-oxopentoxy)ethyl]-4-oxobutanamide.
| Compound Name | 4-[3-(5-methylhexyl)-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),4,7,9,11,15,17-octaen-13-yl]-N-[2-(4-methyl-3-oxopentoxy)ethyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 160616157 |
| Molecular Formula | C34H45N5O4 |
| Molecular Weight | 587.76 g/mol |
| Exact Mass | 587.35 |
| IUPAC Name | 4-[3-(5-methylhexyl)-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),4,7,9,11,15,17-octaen-13-yl]-N-[2-(4-methyl-3-oxopentoxy)ethyl]-4-oxobutanamide |
| SMILES | CC(C)CCCCn1nnc2c1-c1ccccc1CN(C(=O)CCC(=O)NCCOCCC(=O)C(C)C)c1ccccc1-2 |
| InChI | InChI=1S/C34H45N5O4/c1-24(2)11-9-10-20-39-34-27-13-6-5-12-26(27)23-38(29-15-8-7-14-28(29)33(34)36-37-39)32(42)17-16-31(41)35-19-22-43-21-18-30(40)25(3)4/h5-8,12-15,24-25H,9-11,16-23H2,1-4H3,(H,35,41) |
| InChIKey | RGCSOFQSRKRTGX-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.76 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|