C32H39N5O6 — CID 155794958
propan-2-yl 2-[13-[4-[2-(4-methyl-3-oxopentoxy)ethylamino]-4-oxobutanoyl]-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),4,7,9,11,15,17-octaen-3-yl]acetate (PubChem CID 155794958) has the molecular formula C32H39N5O6 and a molecular weight of 589.69 g/mol. Its IUPAC name is propan-2-yl 2-[13-[4-[2-(4-methyl-3-oxopentoxy)ethylamino]-4-oxobutanoyl]-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),4,7,9,11,15,17-octaen-3-yl]acetate.
| Compound Name | propan-2-yl 2-[13-[4-[2-(4-methyl-3-oxopentoxy)ethylamino]-4-oxobutanoyl]-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),4,7,9,11,15,17-octaen-3-yl]acetate |
|---|---|
| PubChem CID | 155794958 |
| Molecular Formula | C32H39N5O6 |
| Molecular Weight | 589.69 g/mol |
| Exact Mass | 589.29 |
| IUPAC Name | propan-2-yl 2-[13-[4-[2-(4-methyl-3-oxopentoxy)ethylamino]-4-oxobutanoyl]-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),4,7,9,11,15,17-octaen-3-yl]acetate |
| SMILES | CC(C)OC(=O)Cn1nnc2c1-c1ccccc1CN(C(=O)CCC(=O)NCCOCCC(=O)C(C)C)c1ccccc1-2 |
| InChI | InChI=1S/C32H39N5O6/c1-21(2)27(38)15-17-42-18-16-33-28(39)13-14-29(40)36-19-23-9-5-6-10-24(23)32-31(25-11-7-8-12-26(25)36)34-35-37(32)20-30(41)43-22(3)4/h5-12,21-22H,13-20H2,1-4H3,(H,33,39) |
| InChIKey | DXVGCFDILLQNHG-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 132.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.69 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|