C37H49N5O7 — CID 167260117
2-methoxyethyl 2-[13-[4-[[3-methyl-3-(2,2,4-trimethyl-3-oxopentoxy)butyl]amino]-4-oxobutanoyl]-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),4,7,9,11,15,17-octaen-3-yl]acetate (PubChem CID 167260117) has the molecular formula C37H49N5O7 and a molecular weight of 675.83 g/mol. Its IUPAC name is 2-methoxyethyl 2-[13-[4-[[3-methyl-3-(2,2,4-trimethyl-3-oxopentoxy)butyl]amino]-4-oxobutanoyl]-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),4,7,9,11,15,17-octaen-3-yl]acetate.
| Compound Name | 2-methoxyethyl 2-[13-[4-[[3-methyl-3-(2,2,4-trimethyl-3-oxopentoxy)butyl]amino]-4-oxobutanoyl]-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),4,7,9,11,15,17-octaen-3-yl]acetate |
|---|---|
| PubChem CID | 167260117 |
| Molecular Formula | C37H49N5O7 |
| Molecular Weight | 675.83 g/mol |
| Exact Mass | 675.36 |
| IUPAC Name | 2-methoxyethyl 2-[13-[4-[[3-methyl-3-(2,2,4-trimethyl-3-oxopentoxy)butyl]amino]-4-oxobutanoyl]-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),4,7,9,11,15,17-octaen-3-yl]acetate |
| SMILES | COCCOC(=O)Cn1nnc2c1-c1ccccc1CN(C(=O)CCC(=O)NCCC(C)(C)OCC(C)(C)C(=O)C(C)C)c1ccccc1-2 |
| InChI | InChI=1S/C37H49N5O7/c1-25(2)35(46)36(3,4)24-49-37(5,6)18-19-38-30(43)16-17-31(44)41-22-26-12-8-9-13-27(26)34-33(28-14-10-11-15-29(28)41)39-40-42(34)23-32(45)48-21-20-47-7/h8-15,25H,16-24H2,1-7H3,(H,38,43) |
| InChIKey | CVGSSIFRTYNSGU-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 141.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.83 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|