C24H26N2O4 — CID 167035217
5-[[4-[(11Z)-6H-benzo[c][1]benzazocin-5-yl]-4-oxobutanoyl]amino]pentanoic acid (PubChem CID 167035217) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is 5-[[4-[(11Z)-6H-benzo[c][1]benzazocin-5-yl]-4-oxobutanoyl]amino]pentanoic acid.
| Compound Name | 5-[[4-[(11Z)-6H-benzo[c][1]benzazocin-5-yl]-4-oxobutanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 167035217 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 5-[[4-[(11Z)-6H-benzo[c][1]benzazocin-5-yl]-4-oxobutanoyl]amino]pentanoic acid |
| SMILES | O=C(O)CCCCNC(=O)CCC(=O)N1Cc2ccccc2/C=C\c2ccccc21 |
| InChI | InChI=1S/C24H26N2O4/c27-22(25-16-6-5-11-24(29)30)14-15-23(28)26-17-20-9-2-1-7-18(20)12-13-19-8-3-4-10-21(19)26/h1-4,7-10,12-13H,5-6,11,14-17H2,(H,25,27)(H,29,30)/b13-12- |
| InChIKey | VGRIOMBLRRQZIG-SEYXRHQNSA-N |
| XLogP | 3.85 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|