C22H21F3N2O2 — CID 162620858
N-[5-(6H-benzo[c][1]benzazocin-5-yl)-5-oxopentyl]-2,2,2-trifluoroacetamide (PubChem CID 162620858) has the molecular formula C22H21F3N2O2 and a molecular weight of 402.42 g/mol. Its IUPAC name is N-[5-(6H-benzo[c][1]benzazocin-5-yl)-5-oxopentyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[5-(6H-benzo[c][1]benzazocin-5-yl)-5-oxopentyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 162620858 |
| Molecular Formula | C22H21F3N2O2 |
| Molecular Weight | 402.42 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | N-[5-(6H-benzo[c][1]benzazocin-5-yl)-5-oxopentyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(CCCCNC(=O)C(F)(F)F)N1Cc2ccccc2C=Cc2ccccc21 |
| InChI | InChI=1S/C22H21F3N2O2/c23-22(24,25)21(29)26-14-6-5-11-20(28)27-15-18-9-2-1-7-16(18)12-13-17-8-3-4-10-19(17)27/h1-4,7-10,12-13H,5-6,11,14-15H2,(H,26,29) |
| InChIKey | UDXXUKMAXACVEA-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.42 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|