C24H31N5O2 — CID 178091009
4-[(11Z)-12-amino-11-[amino(methyl)amino]-6H-benzo[c][1]benzazocin-5-yl]-N-butyl-4-oxobutanamide (PubChem CID 178091009) has the molecular formula C24H31N5O2 and a molecular weight of 421.55 g/mol. Its IUPAC name is 4-[(11Z)-12-amino-11-[amino(methyl)amino]-6H-benzo[c][1]benzazocin-5-yl]-N-butyl-4-oxobutanamide.
| Compound Name | 4-[(11Z)-12-amino-11-[amino(methyl)amino]-6H-benzo[c][1]benzazocin-5-yl]-N-butyl-4-oxobutanamide |
|---|---|
| PubChem CID | 178091009 |
| Molecular Formula | C24H31N5O2 |
| Molecular Weight | 421.55 g/mol |
| Exact Mass | 421.25 |
| IUPAC Name | 4-[(11Z)-12-amino-11-[amino(methyl)amino]-6H-benzo[c][1]benzazocin-5-yl]-N-butyl-4-oxobutanamide |
| SMILES | CCCCNC(=O)CCC(=O)N1Cc2ccccc2/C(N(C)N)=C(/N)c2ccccc21 |
| InChI | InChI=1S/C24H31N5O2/c1-3-4-15-27-21(30)13-14-22(31)29-16-17-9-5-6-10-18(17)24(28(2)26)23(25)19-11-7-8-12-20(19)29/h5-12H,3-4,13-16,25-26H2,1-2H3,(H,27,30)/b24-23- |
| InChIKey | ZTTMCFUFYWCIFF-VHXPQNKSSA-N |
| XLogP | 2.82 |
| TPSA | 104.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.55 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|