C25H29N5O5 — CID 175630088
2-[amino-[(11Z)-12-amino-5-(4-nitroso-4-oxobutanoyl)-6H-benzo[c][1]benzazocin-11-yl]amino]ethyl 2-methylpropanoate (PubChem CID 175630088) has the molecular formula C25H29N5O5 and a molecular weight of 479.54 g/mol. Its IUPAC name is 2-[amino-[(11Z)-12-amino-5-(4-nitroso-4-oxobutanoyl)-6H-benzo[c][1]benzazocin-11-yl]amino]ethyl 2-methylpropanoate.
| Compound Name | 2-[amino-[(11Z)-12-amino-5-(4-nitroso-4-oxobutanoyl)-6H-benzo[c][1]benzazocin-11-yl]amino]ethyl 2-methylpropanoate |
|---|---|
| PubChem CID | 175630088 |
| Molecular Formula | C25H29N5O5 |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | 2-[amino-[(11Z)-12-amino-5-(4-nitroso-4-oxobutanoyl)-6H-benzo[c][1]benzazocin-11-yl]amino]ethyl 2-methylpropanoate |
| SMILES | CC(C)C(=O)OCCN(N)/C1=C(\N)c2ccccc2N(C(=O)CCC(=O)N=O)Cc2ccccc21 |
| InChI | InChI=1S/C25H29N5O5/c1-16(2)25(33)35-14-13-30(27)24-18-8-4-3-7-17(18)15-29(22(32)12-11-21(31)28-34)20-10-6-5-9-19(20)23(24)26/h3-10,16H,11-15,26-27H2,1-2H3/b24-23- |
| InChIKey | CZIZLGHINBTIDQ-VHXPQNKSSA-N |
| XLogP | 2.77 |
| TPSA | 148.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|