C32H44N6O4 — CID 144960929
(Z)-N-[5-[(11Z)-12-amino-11-[amino-[3-methyl-3-(methylaminomethoxy)butyl]amino]-6H-benzo[c][1]benzazocin-5-yl]-5-oxopentyl]-N-methyl-4-oxobut-2-enamide (PubChem CID 144960929) has the molecular formula C32H44N6O4 and a molecular weight of 576.74 g/mol. Its IUPAC name is (Z)-N-[5-[(11Z)-12-amino-11-[amino-[3-methyl-3-(methylaminomethoxy)butyl]amino]-6H-benzo[c][1]benzazocin-5-yl]-5-oxopentyl]-N-methyl-4-oxobut-2-enamide.
| Compound Name | (Z)-N-[5-[(11Z)-12-amino-11-[amino-[3-methyl-3-(methylaminomethoxy)butyl]amino]-6H-benzo[c][1]benzazocin-5-yl]-5-oxopentyl]-N-methyl-4-oxobut-2-enamide |
|---|---|
| PubChem CID | 144960929 |
| Molecular Formula | C32H44N6O4 |
| Molecular Weight | 576.74 g/mol |
| Exact Mass | 576.34 |
| IUPAC Name | (Z)-N-[5-[(11Z)-12-amino-11-[amino-[3-methyl-3-(methylaminomethoxy)butyl]amino]-6H-benzo[c][1]benzazocin-5-yl]-5-oxopentyl]-N-methyl-4-oxobut-2-enamide |
| SMILES | CNCOC(C)(C)CCN(N)/C1=C(\N)c2ccccc2N(C(=O)CCCCN(C)C(=O)/C=C\C=O)Cc2ccccc21 |
| InChI | InChI=1S/C32H44N6O4/c1-32(2,42-23-35-3)18-20-38(34)31-25-13-6-5-12-24(25)22-37(27-15-8-7-14-26(27)30(31)33)29(41)16-9-10-19-36(4)28(40)17-11-21-39/h5-8,11-15,17,21,35H,9-10,16,18-20,22-23,33-34H2,1-4H3/b17-11-,31-30- |
| InChIKey | AMYXZFTXPXOGIE-HGMDAHEZSA-N |
| XLogP | 3.24 |
| TPSA | 134.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.74 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|