C21H27N5O2 — CID 142291738
2-[[(11Z)-5-acetyl-12-amino-6H-benzo[c][1]benzazocin-11-yl]-aminoamino]acetamide;ethane (PubChem CID 142291738) has the molecular formula C21H27N5O2 and a molecular weight of 381.48 g/mol. Its IUPAC name is 2-[[(11Z)-5-acetyl-12-amino-6H-benzo[c][1]benzazocin-11-yl]-aminoamino]acetamide;ethane.
| Compound Name | 2-[[(11Z)-5-acetyl-12-amino-6H-benzo[c][1]benzazocin-11-yl]-aminoamino]acetamide;ethane |
|---|---|
| PubChem CID | 142291738 |
| Molecular Formula | C21H27N5O2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 2-[[(11Z)-5-acetyl-12-amino-6H-benzo[c][1]benzazocin-11-yl]-aminoamino]acetamide;ethane |
| SMILES | CC.CC(=O)N1Cc2ccccc2/C(N(N)CC(N)=O)=C(/N)c2ccccc21 |
| InChI | InChI=1S/C19H21N5O2.C2H6/c1-12(25)23-10-13-6-2-3-7-14(13)19(24(22)11-17(20)26)18(21)15-8-4-5-9-16(15)23;1-2/h2-9H,10-11,21-22H2,1H3,(H2,20,26);1-2H3/b19-18-; |
| InChIKey | OQZINRNRXKZZPZ-TVWXOORISA-N |
| XLogP | 2.02 |
| TPSA | 118.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|