C18H25N4P — CID 144590175
(11Z)-11-[amino(phosphanyl)amino]-5-methyl-6H-benzo[c][1]benzazocin-12-amine;ethane (PubChem CID 144590175) has the molecular formula C18H25N4P and a molecular weight of 328.40 g/mol. Its IUPAC name is (11Z)-11-[amino(phosphanyl)amino]-5-methyl-6H-benzo[c][1]benzazocin-12-amine;ethane.
| Compound Name | (11Z)-11-[amino(phosphanyl)amino]-5-methyl-6H-benzo[c][1]benzazocin-12-amine;ethane |
|---|---|
| PubChem CID | 144590175 |
| Molecular Formula | C18H25N4P |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | (11Z)-11-[amino(phosphanyl)amino]-5-methyl-6H-benzo[c][1]benzazocin-12-amine;ethane |
| SMILES | CC.CN1Cc2ccccc2/C(N(N)P)=C(/N)c2ccccc21 |
| InChI | InChI=1S/C16H19N4P.C2H6/c1-19-10-11-6-2-3-7-12(11)16(20(18)21)15(17)13-8-4-5-9-14(13)19;1-2/h2-9H,10,17-18,21H2,1H3;1-2H3/b16-15-; |
| InChIKey | KJCFEFOQYQSSEC-YFKNTREVSA-N |
| XLogP | 3.41 |
| TPSA | 58.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|