C21H34N4 — CID 153397876
(3Z,5Z)-6-[amino(methyl)amino]-3,4-bis(ethenyl)-1-methyl-2H-1-benzazocin-5-amine;ethane (PubChem CID 153397876) has the molecular formula C21H34N4 and a molecular weight of 342.53 g/mol. Its IUPAC name is (3Z,5Z)-6-[amino(methyl)amino]-3,4-bis(ethenyl)-1-methyl-2H-1-benzazocin-5-amine;ethane.
| Compound Name | (3Z,5Z)-6-[amino(methyl)amino]-3,4-bis(ethenyl)-1-methyl-2H-1-benzazocin-5-amine;ethane |
|---|---|
| PubChem CID | 153397876 |
| Molecular Formula | C21H34N4 |
| Molecular Weight | 342.53 g/mol |
| Exact Mass | 342.28 |
| IUPAC Name | (3Z,5Z)-6-[amino(methyl)amino]-3,4-bis(ethenyl)-1-methyl-2H-1-benzazocin-5-amine;ethane |
| SMILES | C=C/C1=C(C=C)/C(N)=C(/N(C)N)c2ccccc2N(C)C1.CC.CC |
| InChI | InChI=1S/C17H22N4.2C2H6/c1-5-12-11-20(3)15-10-8-7-9-14(15)17(21(4)19)16(18)13(12)6-2;2*1-2/h5-10H,1-2,11,18-19H2,3-4H3;2*1-2H3/b13-12-,17-16-;; |
| InChIKey | KPJVVJHLKVQNPC-LBRGPOGYSA-N |
| XLogP | 4.29 |
| TPSA | 58.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.53 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|