C28H29N — CID 144597079
2,3-bis(ethenyl)-1H-indene;ethane;9-methylcarbazole (PubChem CID 144597079) has the molecular formula C28H29N and a molecular weight of 379.55 g/mol. Its IUPAC name is 2,3-bis(ethenyl)-1H-indene;ethane;9-methylcarbazole.
| Compound Name | 2,3-bis(ethenyl)-1H-indene;ethane;9-methylcarbazole |
|---|---|
| PubChem CID | 144597079 |
| Molecular Formula | C28H29N |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | 2,3-bis(ethenyl)-1H-indene;ethane;9-methylcarbazole |
| SMILES | C=CC1=C(C=C)c2ccccc2C1.CC.Cn1c2ccccc2c2ccccc21 |
| InChI | InChI=1S/C13H11N.C13H12.C2H6/c1-14-12-8-4-2-6-10(12)11-7-3-5-9-13(11)14;1-3-10-9-11-7-5-6-8-13(11)12(10)4-2;1-2/h2-9H,1H3;3-8H,1-2,9H2;1-2H3 |
| InChIKey | IDCYICBTYCFNCS-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |