C14H17N — CID 145072090
5,6-bis(ethenyl)-7H-cyclopenta[b]pyridine;ethane (PubChem CID 145072090) has the molecular formula C14H17N and a molecular weight of 199.30 g/mol. Its IUPAC name is 5,6-bis(ethenyl)-7H-cyclopenta[b]pyridine;ethane.
| Compound Name | 5,6-bis(ethenyl)-7H-cyclopenta[b]pyridine;ethane |
|---|---|
| PubChem CID | 145072090 |
| Molecular Formula | C14H17N |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | 5,6-bis(ethenyl)-7H-cyclopenta[b]pyridine;ethane |
| SMILES | C=CC1=C(C=C)c2cccnc2C1.CC |
| InChI | InChI=1S/C12H11N.C2H6/c1-3-9-8-12-11(10(9)4-2)6-5-7-13-12;1-2/h3-7H,1-2,8H2;1-2H3 |
| InChIKey | AVIQOSVHYITLJR-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |