C16H17N — CID 157054008
5,6,7,8-tetramethyl-9H-indeno[2,1-b]pyridine (PubChem CID 157054008) has the molecular formula C16H17N and a molecular weight of 223.32 g/mol. Its IUPAC name is 5,6,7,8-tetramethyl-9H-indeno[2,1-b]pyridine.
| Compound Name | 5,6,7,8-tetramethyl-9H-indeno[2,1-b]pyridine |
|---|---|
| PubChem CID | 157054008 |
| Molecular Formula | C16H17N |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 5,6,7,8-tetramethyl-9H-indeno[2,1-b]pyridine |
| SMILES | Cc1c(C)c(C)c2c(c1C)Cc1ncccc1-2 |
| InChI | InChI=1S/C16H17N/c1-9-10(2)12(4)16-13-6-5-7-17-15(13)8-14(16)11(9)3/h5-7H,8H2,1-4H3 |
| InChIKey | ZHLNXRKDKVCMTE-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |