C9H9NS — CID 143590965
3-methyl-4H-thiopyrano[3,2-b]pyridine (PubChem CID 143590965) has the molecular formula C9H9NS and a molecular weight of 163.25 g/mol. Its IUPAC name is 3-methyl-4H-thiopyrano[3,2-b]pyridine.
| Compound Name | 3-methyl-4H-thiopyrano[3,2-b]pyridine |
|---|---|
| PubChem CID | 143590965 |
| Molecular Formula | C9H9NS |
| Molecular Weight | 163.25 g/mol |
| Exact Mass | 163.05 |
| IUPAC Name | 3-methyl-4H-thiopyrano[3,2-b]pyridine |
| SMILES | CC1=CSc2cccnc2C1 |
| InChI | InChI=1S/C9H9NS/c1-7-5-8-9(11-6-7)3-2-4-10-8/h2-4,6H,5H2,1H3 |
| InChIKey | MVEMVSMVSIODQF-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.25 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |