C18H17N — CID 159564863
7-isocyano-1,2,3,4-tetramethyl-9H-fluorene (PubChem CID 159564863) has the molecular formula C18H17N and a molecular weight of 247.34 g/mol. Its IUPAC name is 7-isocyano-1,2,3,4-tetramethyl-9H-fluorene.
| Compound Name | 7-isocyano-1,2,3,4-tetramethyl-9H-fluorene |
|---|---|
| PubChem CID | 159564863 |
| Molecular Formula | C18H17N |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 7-isocyano-1,2,3,4-tetramethyl-9H-fluorene |
| SMILES | [C-]#[N+]c1ccc2c(c1)Cc1c(C)c(C)c(C)c(C)c1-2 |
| InChI | InChI=1S/C18H17N/c1-10-11(2)13(4)18-16-7-6-15(19-5)8-14(16)9-17(18)12(10)3/h6-8H,9H2,1-4H3 |
| InChIKey | UWZQCJSUEADKFD-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|