C9H6N2O — CID 123852745
5-isocyano-2,3-dihydroisoindol-1-one (PubChem CID 123852745) has the molecular formula C9H6N2O and a molecular weight of 158.16 g/mol. Its IUPAC name is 5-isocyano-2,3-dihydroisoindol-1-one.
| Compound Name | 5-isocyano-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 123852745 |
| Molecular Formula | C9H6N2O |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | 5-isocyano-2,3-dihydroisoindol-1-one |
| SMILES | [C-]#[N+]c1ccc2c(c1)CNC2=O |
| InChI | InChI=1S/C9H6N2O/c1-10-7-2-3-8-6(4-7)5-11-9(8)12/h2-4H,5H2,(H,11,12) |
| InChIKey | QURDBNAYJROLFI-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 33.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|