C13H13N3O — CID 123922727
5-[(1-isocyanocyclobutyl)amino]-2,3-dihydroisoindol-1-one (PubChem CID 123922727) has the molecular formula C13H13N3O and a molecular weight of 227.27 g/mol. Its IUPAC name is 5-[(1-isocyanocyclobutyl)amino]-2,3-dihydroisoindol-1-one.
| Compound Name | 5-[(1-isocyanocyclobutyl)amino]-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 123922727 |
| Molecular Formula | C13H13N3O |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 5-[(1-isocyanocyclobutyl)amino]-2,3-dihydroisoindol-1-one |
| SMILES | [C-]#[N+]C1(Nc2ccc3c(c2)CNC3=O)CCC1 |
| InChI | InChI=1S/C13H13N3O/c1-14-13(5-2-6-13)16-10-3-4-11-9(7-10)8-15-12(11)17/h3-4,7,16H,2,5-6,8H2,(H,15,17) |
| InChIKey | OPRLSZFBFSKCSD-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 45.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|