C24H22Cl2N2O2 — CID 67160058
bis(5-chloro-2,3-dihydroisoindol-1-one);1,3-xylene (PubChem CID 67160058) has the molecular formula C24H22Cl2N2O2 and a molecular weight of 441.36 g/mol. Its IUPAC name is bis(5-chloro-2,3-dihydroisoindol-1-one);1,3-xylene.
| Compound Name | bis(5-chloro-2,3-dihydroisoindol-1-one);1,3-xylene |
|---|---|
| PubChem CID | 67160058 |
| Molecular Formula | C24H22Cl2N2O2 |
| Molecular Weight | 441.36 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | bis(5-chloro-2,3-dihydroisoindol-1-one);1,3-xylene |
| SMILES | Cc1cccc(C)c1.O=C1NCc2cc(Cl)ccc21.O=C1NCc2cc(Cl)ccc21 |
| InChI | InChI=1S/2C8H6ClNO.C8H10/c2*9-6-1-2-7-5(3-6)4-10-8(7)11;1-7-4-3-5-8(2)6-7/h2*1-3H,4H2,(H,10,11);3-6H,1-2H3 |
| InChIKey | AFFWCZGGYHBNQG-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.36 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |