About bis(5-chloro-2,3-dihydroisoindol-1-one);1,3-xylene
bis(5-chloro-2,3-dihydroisoindol-1-one);1,3-xylene (PubChem CID 67160058) has the molecular formula C24H22Cl2N2O2
and a molecular weight of 441.36 g/mol. Its IUPAC name is bis(5-chloro-2,3-dihydroisoindol-1-one);1,3-xylene.
Molecular Properties
| Compound Name | bis(5-chloro-2,3-dihydroisoindol-1-one);1,3-xylene |
| PubChem CID | 67160058 |
| Molecular Formula | C24H22Cl2N2O2 |
| Molecular Weight | 441.36 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | bis(5-chloro-2,3-dihydroisoindol-1-one);1,3-xylene |
| SMILES | Cc1cccc(C)c1.O=C1NCc2cc(Cl)ccc21.O=C1NCc2cc(Cl)ccc21 |
| InChI | InChI=1S/2C8H6ClNO.C8H10/c2*9-6-1-2-7-5(3-6)4-10-8(7)11;1-7-4-3-5-8(2)6-7/h2*1-3H,4H2,(H,10,11);3-6H,1-2H3 |
| InChIKey | AFFWCZGGYHBNQG-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 441.36 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze bis(5-chloro-2,3-dihydroisoindol-1-one);1,3-xylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(5-chloro-2,3-dihydroisoindol-1-one);1,3-xylene?
The IUPAC name of bis(5-chloro-2,3-dihydroisoindol-1-one);1,3-xylene (CID 67160058) is bis(5-chloro-2,3-dihydroisoindol-1-one);1,3-xylene.
What is the SMILES notation for bis(5-chloro-2,3-dihydroisoindol-1-one);1,3-xylene?
The canonical SMILES for bis(5-chloro-2,3-dihydroisoindol-1-one);1,3-xylene is Cc1cccc(C)c1.O=C1NCc2cc(Cl)ccc21.O=C1NCc2cc(Cl)ccc21.
What is the InChIKey of bis(5-chloro-2,3-dihydroisoindol-1-one);1,3-xylene?
The InChIKey is AFFWCZGGYHBNQG-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H6ClNO.C8H10/c2*9-6-1-2-7-5(3-6)4-10-8(7)11;1-7-4-3-5-8(2)6-7/h2*1-3H,4H2,(H,10,11);3-6H,1-2H3.
What are the key properties of bis(5-chloro-2,3-dihydroisoindol-1-one);1,3-xylene?
bis(5-chloro-2,3-dihydroisoindol-1-one);1,3-xylene has a molecular weight of 441.36 g/mol, XLogP of 5.47, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(5-chloro-2,3-dihydroisoindol-1-one);1,3-xylene is sourced from PubChem (CID 67160058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).