C14H10ClNO — CID 172769018
4-(4-chlorophenyl)-2,3-dihydroisoindol-1-one (PubChem CID 172769018) has the molecular formula C14H10ClNO and a molecular weight of 243.69 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2,3-dihydroisoindol-1-one.
| Compound Name | 4-(4-chlorophenyl)-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 172769018 |
| Molecular Formula | C14H10ClNO |
| Molecular Weight | 243.69 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 4-(4-chlorophenyl)-2,3-dihydroisoindol-1-one |
| SMILES | O=C1NCc2c1cccc2-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H10ClNO/c15-10-6-4-9(5-7-10)11-2-1-3-12-13(11)8-16-14(12)17/h1-7H,8H2,(H,16,17) |
| InChIKey | MRVLEFBBFFTVRY-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.69 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |