C21H17N3O2 — CID 5329877
1-[4-(1-oxo-2,3-dihydroisoindol-4-yl)phenyl]-3-phenylurea (PubChem CID 5329877) has the molecular formula C21H17N3O2 and a molecular weight of 343.39 g/mol. Its IUPAC name is 1-[4-(1-oxo-2,3-dihydroisoindol-4-yl)phenyl]-3-phenylurea.
| Compound Name | 1-[4-(1-oxo-2,3-dihydroisoindol-4-yl)phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 5329877 |
| Molecular Formula | C21H17N3O2 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 1-[4-(1-oxo-2,3-dihydroisoindol-4-yl)phenyl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)Nc1ccc(-c2cccc3c2CNC3=O)cc1 |
| InChI | InChI=1S/C21H17N3O2/c25-20-18-8-4-7-17(19(18)13-22-20)14-9-11-16(12-10-14)24-21(26)23-15-5-2-1-3-6-15/h1-12H,13H2,(H,22,25)(H2,23,24,26) |
| InChIKey | IYRHDBQVTFEVNI-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |