C22H19N3O2 — CID 70690322
1-(3-methylphenyl)-3-[4-(3-oxo-1,2-dihydroisoindol-4-yl)phenyl]urea (PubChem CID 70690322) has the molecular formula C22H19N3O2 and a molecular weight of 357.41 g/mol. Its IUPAC name is 1-(3-methylphenyl)-3-[4-(3-oxo-1,2-dihydroisoindol-4-yl)phenyl]urea.
| Compound Name | 1-(3-methylphenyl)-3-[4-(3-oxo-1,2-dihydroisoindol-4-yl)phenyl]urea |
|---|---|
| PubChem CID | 70690322 |
| Molecular Formula | C22H19N3O2 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 1-(3-methylphenyl)-3-[4-(3-oxo-1,2-dihydroisoindol-4-yl)phenyl]urea |
| SMILES | Cc1cccc(NC(=O)Nc2ccc(-c3cccc4c3C(=O)NC4)cc2)c1 |
| InChI | InChI=1S/C22H19N3O2/c1-14-4-2-6-18(12-14)25-22(27)24-17-10-8-15(9-11-17)19-7-3-5-16-13-23-21(26)20(16)19/h2-12H,13H2,1H3,(H,23,26)(H2,24,25,27) |
| InChIKey | OYHPEJNWMYOFGL-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |