C22H18N4O4 — CID 11406975
1-(3-methylphenyl)-3-[4-(6-nitro-1-oxo-2,3-dihydroisoindol-4-yl)phenyl]urea (PubChem CID 11406975) has the molecular formula C22H18N4O4 and a molecular weight of 402.41 g/mol. Its IUPAC name is 1-(3-methylphenyl)-3-[4-(6-nitro-1-oxo-2,3-dihydroisoindol-4-yl)phenyl]urea.
| Compound Name | 1-(3-methylphenyl)-3-[4-(6-nitro-1-oxo-2,3-dihydroisoindol-4-yl)phenyl]urea |
|---|---|
| PubChem CID | 11406975 |
| Molecular Formula | C22H18N4O4 |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 1-(3-methylphenyl)-3-[4-(6-nitro-1-oxo-2,3-dihydroisoindol-4-yl)phenyl]urea |
| SMILES | Cc1cccc(NC(=O)Nc2ccc(-c3cc([N+](=O)[O-])cc4c3CNC4=O)cc2)c1 |
| InChI | InChI=1S/C22H18N4O4/c1-13-3-2-4-16(9-13)25-22(28)24-15-7-5-14(6-8-15)18-10-17(26(29)30)11-19-20(18)12-23-21(19)27/h2-11H,12H2,1H3,(H,23,27)(H2,24,25,28) |
| InChIKey | MNHPLUUSUSVPPT-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|