C21H16BrN3O2 — CID 11350703
1-(2-bromophenyl)-3-[4-(1-oxo-2,3-dihydroisoindol-4-yl)phenyl]urea (PubChem CID 11350703) has the molecular formula C21H16BrN3O2 and a molecular weight of 422.28 g/mol. Its IUPAC name is 1-(2-bromophenyl)-3-[4-(1-oxo-2,3-dihydroisoindol-4-yl)phenyl]urea.
| Compound Name | 1-(2-bromophenyl)-3-[4-(1-oxo-2,3-dihydroisoindol-4-yl)phenyl]urea |
|---|---|
| PubChem CID | 11350703 |
| Molecular Formula | C21H16BrN3O2 |
| Molecular Weight | 422.28 g/mol |
| Exact Mass | 421.04 |
| IUPAC Name | 1-(2-bromophenyl)-3-[4-(1-oxo-2,3-dihydroisoindol-4-yl)phenyl]urea |
| SMILES | O=C(Nc1ccc(-c2cccc3c2CNC3=O)cc1)Nc1ccccc1Br |
| InChI | InChI=1S/C21H16BrN3O2/c22-18-6-1-2-7-19(18)25-21(27)24-14-10-8-13(9-11-14)15-4-3-5-16-17(15)12-23-20(16)26/h1-11H,12H2,(H,23,26)(H2,24,25,27) |
| InChIKey | VZWRCOOETGQOOF-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.28 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |