C22H17BrN4O3S — CID 174407941
1-(2-bromophenyl)-3-[4-(2-sulfamoylquinolin-8-yl)phenyl]urea (PubChem CID 174407941) has the molecular formula C22H17BrN4O3S and a molecular weight of 497.37 g/mol. Its IUPAC name is 1-(2-bromophenyl)-3-[4-(2-sulfamoylquinolin-8-yl)phenyl]urea.
| Compound Name | 1-(2-bromophenyl)-3-[4-(2-sulfamoylquinolin-8-yl)phenyl]urea |
|---|---|
| PubChem CID | 174407941 |
| Molecular Formula | C22H17BrN4O3S |
| Molecular Weight | 497.37 g/mol |
| Exact Mass | 496.02 |
| IUPAC Name | 1-(2-bromophenyl)-3-[4-(2-sulfamoylquinolin-8-yl)phenyl]urea |
| SMILES | NS(=O)(=O)c1ccc2cccc(-c3ccc(NC(=O)Nc4ccccc4Br)cc3)c2n1 |
| InChI | InChI=1S/C22H17BrN4O3S/c23-18-6-1-2-7-19(18)26-22(28)25-16-11-8-14(9-12-16)17-5-3-4-15-10-13-20(27-21(15)17)31(24,29)30/h1-13H,(H2,24,29,30)(H2,25,26,28) |
| InChIKey | JJGCPAXNJZLDFK-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.37 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |