C20H16BrN5O — CID 25134915
1-[4-(1-aminoimidazo[1,5-a]pyridin-8-yl)phenyl]-3-(2-bromophenyl)urea (PubChem CID 25134915) has the molecular formula C20H16BrN5O and a molecular weight of 422.29 g/mol. Its IUPAC name is 1-[4-(1-aminoimidazo[1,5-a]pyridin-8-yl)phenyl]-3-(2-bromophenyl)urea.
| Compound Name | 1-[4-(1-aminoimidazo[1,5-a]pyridin-8-yl)phenyl]-3-(2-bromophenyl)urea |
|---|---|
| PubChem CID | 25134915 |
| Molecular Formula | C20H16BrN5O |
| Molecular Weight | 422.29 g/mol |
| Exact Mass | 421.05 |
| IUPAC Name | 1-[4-(1-aminoimidazo[1,5-a]pyridin-8-yl)phenyl]-3-(2-bromophenyl)urea |
| SMILES | Nc1ncn2cccc(-c3ccc(NC(=O)Nc4ccccc4Br)cc3)c12 |
| InChI | InChI=1S/C20H16BrN5O/c21-16-5-1-2-6-17(16)25-20(27)24-14-9-7-13(8-10-14)15-4-3-11-26-12-23-19(22)18(15)26/h1-12H,22H2,(H2,24,25,27) |
| InChIKey | GOPDMZOIHDXOCJ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 84.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.29 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |