C20H17N5O — CID 57398846
1-[4-(1H-imidazo[4,5-b]pyridin-7-yl)phenyl]-3-(3-methylphenyl)urea (PubChem CID 57398846) has the molecular formula C20H17N5O and a molecular weight of 343.39 g/mol. Its IUPAC name is 1-[4-(1H-imidazo[4,5-b]pyridin-7-yl)phenyl]-3-(3-methylphenyl)urea.
| Compound Name | 1-[4-(1H-imidazo[4,5-b]pyridin-7-yl)phenyl]-3-(3-methylphenyl)urea |
|---|---|
| PubChem CID | 57398846 |
| Molecular Formula | C20H17N5O |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 1-[4-(1H-imidazo[4,5-b]pyridin-7-yl)phenyl]-3-(3-methylphenyl)urea |
| SMILES | Cc1cccc(NC(=O)Nc2ccc(-c3ccnc4nc[nH]c34)cc2)c1 |
| InChI | InChI=1S/C20H17N5O/c1-13-3-2-4-16(11-13)25-20(26)24-15-7-5-14(6-8-15)17-9-10-21-19-18(17)22-12-23-19/h2-12H,1H3,(H,21,22,23)(H2,24,25,26) |
| InChIKey | GQSDFZXXEZBDPP-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |