C20H16N2O3S — CID 5329879
N-[4-(1-oxo-2,3-dihydroisoindol-4-yl)phenyl]benzenesulfonamide (PubChem CID 5329879) has the molecular formula C20H16N2O3S and a molecular weight of 364.43 g/mol. Its IUPAC name is N-[4-(1-oxo-2,3-dihydroisoindol-4-yl)phenyl]benzenesulfonamide.
| Compound Name | N-[4-(1-oxo-2,3-dihydroisoindol-4-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 5329879 |
| Molecular Formula | C20H16N2O3S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | N-[4-(1-oxo-2,3-dihydroisoindol-4-yl)phenyl]benzenesulfonamide |
| SMILES | O=C1NCc2c1cccc2-c1ccc(NS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H16N2O3S/c23-20-18-8-4-7-17(19(18)13-21-20)14-9-11-15(12-10-14)22-26(24,25)16-5-2-1-3-6-16/h1-12,22H,13H2,(H,21,23) |
| InChIKey | ZRCRWIFHCHDKSW-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |