C16H15N3O4S — CID 35543016
N-[4-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]benzenesulfonamide (PubChem CID 35543016) has the molecular formula C16H15N3O4S and a molecular weight of 345.38 g/mol. Its IUPAC name is N-[4-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]benzenesulfonamide.
| Compound Name | N-[4-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 35543016 |
| Molecular Formula | C16H15N3O4S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | N-[4-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]benzenesulfonamide |
| SMILES | O=C1CNC(=O)N1Cc1ccc(NS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C16H15N3O4S/c20-15-10-17-16(21)19(15)11-12-6-8-13(9-7-12)18-24(22,23)14-4-2-1-3-5-14/h1-9,18H,10-11H2,(H,17,21) |
| InChIKey | AMDPJNNJXINMHW-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|