C17H14F3N3O5S — CID 38894275
N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-4-(trifluoromethoxy)benzenesulfonamide (PubChem CID 38894275) has the molecular formula C17H14F3N3O5S and a molecular weight of 429.38 g/mol. Its IUPAC name is N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-4-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-4-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 38894275 |
| Molecular Formula | C17H14F3N3O5S |
| Molecular Weight | 429.38 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | N-[3-[(2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-4-(trifluoromethoxy)benzenesulfonamide |
| SMILES | O=C1CNC(=O)N1Cc1cccc(NS(=O)(=O)c2ccc(OC(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C17H14F3N3O5S/c18-17(19,20)28-13-4-6-14(7-5-13)29(26,27)22-12-3-1-2-11(8-12)10-23-15(24)9-21-16(23)25/h1-8,22H,9-10H2,(H,21,25) |
| InChIKey | GAKXXQPTAYAGKP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|