C19H15F3N2O4S — CID 43069660
N-[3-(pyridin-2-ylmethoxy)phenyl]-4-(trifluoromethoxy)benzenesulfonamide (PubChem CID 43069660) has the molecular formula C19H15F3N2O4S and a molecular weight of 424.40 g/mol. Its IUPAC name is N-[3-(pyridin-2-ylmethoxy)phenyl]-4-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-[3-(pyridin-2-ylmethoxy)phenyl]-4-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 43069660 |
| Molecular Formula | C19H15F3N2O4S |
| Molecular Weight | 424.40 g/mol |
| Exact Mass | 424.07 |
| IUPAC Name | N-[3-(pyridin-2-ylmethoxy)phenyl]-4-(trifluoromethoxy)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cccc(OCc2ccccn2)c1)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C19H15F3N2O4S/c20-19(21,22)28-16-7-9-18(10-8-16)29(25,26)24-14-5-3-6-17(12-14)27-13-15-4-1-2-11-23-15/h1-12,24H,13H2 |
| InChIKey | MWCKWSLGMZWTPF-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.40 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |