C18H14Cl2N2O3S — CID 43069625
2,3-dichloro-N-[3-(pyridin-2-ylmethoxy)phenyl]benzenesulfonamide (PubChem CID 43069625) has the molecular formula C18H14Cl2N2O3S and a molecular weight of 409.29 g/mol. Its IUPAC name is 2,3-dichloro-N-[3-(pyridin-2-ylmethoxy)phenyl]benzenesulfonamide.
| Compound Name | 2,3-dichloro-N-[3-(pyridin-2-ylmethoxy)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 43069625 |
| Molecular Formula | C18H14Cl2N2O3S |
| Molecular Weight | 409.29 g/mol |
| Exact Mass | 408.01 |
| IUPAC Name | 2,3-dichloro-N-[3-(pyridin-2-ylmethoxy)phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cccc(OCc2ccccn2)c1)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C18H14Cl2N2O3S/c19-16-8-4-9-17(18(16)20)26(23,24)22-13-6-3-7-15(11-13)25-12-14-5-1-2-10-21-14/h1-11,22H,12H2 |
| InChIKey | FMPMPCKGWDLFQY-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.29 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |