C19H14ClF3N2O3S — CID 43069632
2-chloro-N-[3-(pyridin-2-ylmethoxy)phenyl]-5-(trifluoromethyl)benzenesulfonamide (PubChem CID 43069632) has the molecular formula C19H14ClF3N2O3S and a molecular weight of 442.85 g/mol. Its IUPAC name is 2-chloro-N-[3-(pyridin-2-ylmethoxy)phenyl]-5-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 2-chloro-N-[3-(pyridin-2-ylmethoxy)phenyl]-5-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 43069632 |
| Molecular Formula | C19H14ClF3N2O3S |
| Molecular Weight | 442.85 g/mol |
| Exact Mass | 442.04 |
| IUPAC Name | 2-chloro-N-[3-(pyridin-2-ylmethoxy)phenyl]-5-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cccc(OCc2ccccn2)c1)c1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C19H14ClF3N2O3S/c20-17-8-7-13(19(21,22)23)10-18(17)29(26,27)25-14-5-3-6-16(11-14)28-12-15-4-1-2-9-24-15/h1-11,25H,12H2 |
| InChIKey | KJDJGUFOWQHACP-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.85 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |