C14H9ClF3N5O2S — CID 8823439
2-chloro-N-[3-(2H-tetrazol-5-yl)phenyl]-5-(trifluoromethyl)benzenesulfonamide (PubChem CID 8823439) has the molecular formula C14H9ClF3N5O2S and a molecular weight of 403.77 g/mol. Its IUPAC name is 2-chloro-N-[3-(2H-tetrazol-5-yl)phenyl]-5-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 2-chloro-N-[3-(2H-tetrazol-5-yl)phenyl]-5-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 8823439 |
| Molecular Formula | C14H9ClF3N5O2S |
| Molecular Weight | 403.77 g/mol |
| Exact Mass | 403.01 |
| IUPAC Name | 2-chloro-N-[3-(2H-tetrazol-5-yl)phenyl]-5-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cccc(-c2nn[nH]n2)c1)c1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C14H9ClF3N5O2S/c15-11-5-4-9(14(16,17)18)7-12(11)26(24,25)21-10-3-1-2-8(6-10)13-19-22-23-20-13/h1-7,21H,(H,19,20,22,23) |
| InChIKey | JHMSBYANCUGBCG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.77 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |