C20H14F3N5O2S — CID 175177926
5-phenyl-N-[3-(2H-tetrazol-5-yl)phenyl]-2-(trifluoromethyl)benzenesulfonamide (PubChem CID 175177926) has the molecular formula C20H14F3N5O2S and a molecular weight of 445.43 g/mol. Its IUPAC name is 5-phenyl-N-[3-(2H-tetrazol-5-yl)phenyl]-2-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 5-phenyl-N-[3-(2H-tetrazol-5-yl)phenyl]-2-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 175177926 |
| Molecular Formula | C20H14F3N5O2S |
| Molecular Weight | 445.43 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | 5-phenyl-N-[3-(2H-tetrazol-5-yl)phenyl]-2-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cccc(-c2nn[nH]n2)c1)c1cc(-c2ccccc2)ccc1C(F)(F)F |
| InChI | InChI=1S/C20H14F3N5O2S/c21-20(22,23)17-10-9-14(13-5-2-1-3-6-13)12-18(17)31(29,30)26-16-8-4-7-15(11-16)19-24-27-28-25-19/h1-12,26H,(H,24,25,27,28) |
| InChIKey | FVIIMMDKJUBQQJ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.43 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |