C18H15N5O2S2 — CID 56942318
5-(2-methylphenyl)-N-[3-(2H-tetrazol-5-yl)phenyl]thiophene-2-sulfonamide (PubChem CID 56942318) has the molecular formula C18H15N5O2S2 and a molecular weight of 397.49 g/mol. Its IUPAC name is 5-(2-methylphenyl)-N-[3-(2H-tetrazol-5-yl)phenyl]thiophene-2-sulfonamide.
| Compound Name | 5-(2-methylphenyl)-N-[3-(2H-tetrazol-5-yl)phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 56942318 |
| Molecular Formula | C18H15N5O2S2 |
| Molecular Weight | 397.49 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | 5-(2-methylphenyl)-N-[3-(2H-tetrazol-5-yl)phenyl]thiophene-2-sulfonamide |
| SMILES | Cc1ccccc1-c1ccc(S(=O)(=O)Nc2cccc(-c3nn[nH]n3)c2)s1 |
| InChI | InChI=1S/C18H15N5O2S2/c1-12-5-2-3-8-15(12)16-9-10-17(26-16)27(24,25)21-14-7-4-6-13(11-14)18-19-22-23-20-18/h2-11,21H,1H3,(H,19,20,22,23) |
| InChIKey | LSJZRNQMBDCFPW-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.49 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |