C11H9ClN6O2S2 — CID 142710697
3-chloro-5-[3-(2H-tetrazol-5-yl)anilino]thiophene-2-sulfonamide (PubChem CID 142710697) has the molecular formula C11H9ClN6O2S2 and a molecular weight of 356.82 g/mol. Its IUPAC name is 3-chloro-5-[3-(2H-tetrazol-5-yl)anilino]thiophene-2-sulfonamide.
| Compound Name | 3-chloro-5-[3-(2H-tetrazol-5-yl)anilino]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 142710697 |
| Molecular Formula | C11H9ClN6O2S2 |
| Molecular Weight | 356.82 g/mol |
| Exact Mass | 355.99 |
| IUPAC Name | 3-chloro-5-[3-(2H-tetrazol-5-yl)anilino]thiophene-2-sulfonamide |
| SMILES | NS(=O)(=O)c1sc(Nc2cccc(-c3nn[nH]n3)c2)cc1Cl |
| InChI | InChI=1S/C11H9ClN6O2S2/c12-8-5-9(21-11(8)22(13,19)20)14-7-3-1-2-6(4-7)10-15-17-18-16-10/h1-5,14H,(H2,13,19,20)(H,15,16,17,18) |
| InChIKey | KOFINWXXDBQTEV-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.82 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |